Bentiromide
From Wikipedia, the free encyclopedia
| Bentiromide | |
|---|---|
 |
|
| IUPAC name | 4-[2-benzamido-3- (4-hydroxyphenyl)- propanoyl] aminobenzoic acid |
| Other names | (S)-4-((2-(benzoylamino)-3-(4-hydroxyphenyl) -1-oxopropyl)amino)benzoic acid (S)-p-(α-benzamido-p-hydroxyhydrocinnamamido) benzoic acid BRN 2910938 Benzoyltyrosyl-p-aminobenzoic acid (Btpaba) C12779 CHEMBANK2959 Chymex D01346 N-benzoyl-L-tyrosyl-p-aminobenzoic acid P-((N-benzoyl-L-tyrosin)amido)benzoic acid PFD PFT Ro 11-7891 |
| Identifiers | |
| Abbreviations | Btpaba |
| CAS number | [37106-97-1] |
| PubChem | |
| EINECS number | |
| SMILES | C1=CC=C(C=C1)C(=O)NC(CC2=CC=C(C=C2)O) C(=O)NC3=CC=C(C=C3)C(=O)O |
| InChI | 1/C23H20N2O5/c26-19-12-6-15(7-13-19)14-20 (25-21(27)16-4-2-1-3-5-16)22(28)24-18-10-8-17 (9-11-18)23(29)30/h1-13,20,26H,14H2,(H,24,28) (H,25,27)(H,29,30)/f/h24-25,29H |
| Properties | |
| Molecular formula | C23H20N2O5 |
| Molar mass | 404.415 |
| Pharmacology | |
| ATC code | |
| DrugBank | |
| Supplementary data page | |
| Structure and properties |
n, εr, etc. |
| Thermodynamic data |
Phase behaviour Solid, liquid, gas |
| Spectral data | UV, IR, NMR, MS |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Bentiromide is a peptide used as a screening test for exocrine pancreatic insufficiency and to monitor the adequacy of supplemental pancreatic therapy. It is given by mouth as a noninvasive test. The amount of 4-aminobenzoic acid and its metabolites excreted in the urine is taken as a measure of the chymotrypsin-secreting activity of the pancreas. Headache and gastrointestinal disturbances have been reported in patients taking bentiromide. Bentiromide is not available in the U.S. or Canada (It was withdrawn in the US in October 1996.)
[edit] Data
- XLogP=3.201
- tautomers=12
- H_bond_donor=4
- H_bond_acceptor=5
[edit] See also
 |
This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |
