Aspartylglucosamine
From Wikipedia, the free encyclopedia
Aspartylglucosamine | |
---|---|
IUPAC name | (2S)-4-[[(2R,3R,4R,5S,6R)-3-Acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-2-amino-4-oxobutanoic acid |
Identifiers | |
CAS number | [2776-93-4] |
PubChem | |
MeSH | |
SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1NC(=O)C[C@@H](C(=O)O)N)CO)O)O |
Properties | |
Molecular formula | C12H21N3O8 |
Molar mass | 335.31 g/mol |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
Aspartylglucosamine is a derivative of aspartic acid.
Levels are elevated in aspartylglucosaminuria.