Arkopal
From Wikipedia, the free encyclopedia
| Arkopal N | |
|---|---|
 |
|
| IUPAC name | 2-[2-(4-nonylphenoxy)ethoxy]ethanol |
| Other names | ethoxylated nonylphenol; (nonylphenoxy)polyethyleneoxide |
| Identifiers | |
| CAS number | [9016-45-9] |
| PubChem | |
| SMILES | CCCCCCCCCC1=CC=C(C=C1)OCCOCCO |
| Properties | |
| Molecular formula | C19H32O3 |
| Molar mass | 308.45558 |
| Hazards | |
| LD50 | 4 g/kg |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Arkopal is a non-ionic surfactant consisting of a hydrophobic 9-carbon atom alkyl tail connected to a phenol molecule, that is in turn connected to an ethylene glycol chain.[1] The length of this ethylene glycol chain is given by the code for the amphiphile Arkopal-N60 means, for example, that there are on average 6 ethylene glycol units connected to the phenol. The average means there are molecules with more and with less ethylene glycols, this is due to the chemical synthesis. Therefore, it has a polydispersity. It is a widely used industrial surfactant.
Contents |
[edit] Uses
It is used as additive in crop protection, lowering surface tension and thereby increasing the effectiveness of the pesticide, and it is used as detergent, for example in oil drilling fluids.
[edit] See also
[edit] References
[edit] Further reading
- J.K.G. Dondt, G. Gomppner, D. Richter (Eds) Soft matter: complex materials on mesoscopic scales - Schriften des Forschungszentrum Jülich, Vol. 10, 2002.
