5-phosphoribosyl-4-carboxy-5-aminoimidazole
From Wikipedia, the free encyclopedia
5-phosphoribosyl-4-carboxy-5-aminoimidazole | |
---|---|
IUPAC name | 5-amino-1-[3,4-dihydroxy-5-(phosphonooxymethyl)- 2-tetrahydrofuranyl]-4-imidazolecarboxylic acid |
Identifiers | |
CAS number | |
PubChem | |
SMILES | C1=NC(=C(N1C2C(C(C(O2)COP(=O)(O)O)O)O)N)C(=O)O |
Properties | |
Molecular formula | C9H14N3O9P |
Molar mass | 339.195921 |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
5-phosphoribosyl-4-carboxy-5-aminoimidazole (or CAIR) is an intermediate in the formation of purines.
It is formed by phosphoribosylaminoimidazole carboxylase.
|