4-Nitroquinoline 1-oxide
From Wikipedia, the free encyclopedia
| 4-Nitroquinoline 1-oxide | |
|---|---|
 |
|
| IUPAC name | 4-Nitro-1-oxidoquinolin-1-ium |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C1=CC=C2C(=C1)C(=CC=[N+]2[O-])[N+](=O)[O-] |
| Properties | |
| Molecular formula | C9H6N2O3 |
| Molar mass | 190.16 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
4-Nitroquinoline 1-oxide (also known as 4-NQO, 4NQO, 4Nqo and NQO) is a tumorigenic compound used in the assessment of the efficacy of diets, drugs, and procedures in the prevention and treatment of cancer in animal models. It induces DNA lesions usually corrected by nucleotide excision repair.
[edit] References
- 4-NQO in NCI Dictionary from PDQ (2004). Verified availability 2005-03-19.
 |
This oncology article is a stub. You can help Wikipedia by expanding it. |
