3-Nitrobenzoic acid
From Wikipedia, the free encyclopedia
| 3-Nitrobenzoic acid | |
|---|---|
 |
|
| IUPAC name | 3-nitrobenzoic acid |
| Other names | m-nitrobenzoic acid |
| Identifiers | |
| CAS number | [121-92-6] |
| PubChem | |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)O |
| Properties | |
| Molecular formula | C7H5NO4 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
3-Nitrobenzoic acid is a benzoic acid derivative that can be prepared by nitration of methyl benzoate with nitric acid (HNO3) followed by saponification.
 |
This article about an aromatic compound is a stub. You can help Wikipedia by expanding it. |
