3-Hydroxykynurenine
From Wikipedia, the free encyclopedia
3-Hydroxykynurenine | |
---|---|
IUPAC name | 2-Amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid |
Identifiers | |
CAS number | [484-78-6] |
PubChem | |
MeSH | |
SMILES | C1=CC(=C(C(=C1)O)N)C(=O)CC(C(=O)O)N |
Properties | |
Molecular formula | C10H12N2O4 |
Molar mass | 224.21 g/mol |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
3-Hydroxykynurenine is a metabolite of tryptophan.
[edit] See also
|