1-Naphthaleneacetamide
From Wikipedia, the free encyclopedia
1-Naphthaleneacetamide | |
---|---|
IUPAC name | 2-Naphthalen-1-ylacetamide |
Other names | 1-Naphthylacetamide |
Identifiers | |
CAS number | [86-86-2] |
PubChem | |
SMILES | C1=CC=C2C(=C1)C=CC=C2CC(=O)N |
Properties | |
Molecular formula | C12H11NO |
Molar mass | 185.222 g/mol |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
1-Naphthaleneacetamide is a synthetic auxin that acts as a rooting hormone. It can be found in commercial products such as Rootone.