1-Deoxy-D-xylulose 5-phosphate
From Wikipedia, the free encyclopedia
1-Deoxy-D-xylulose 5-phosphate | |
---|---|
IUPAC name | (2,3-dihydroxy-4-oxopentyl) dihydrogen phosphate |
Other names | DOXP |
Identifiers | |
CAS number | [190079-18-6] |
PubChem | |
MeSH | |
SMILES | CC(=O)[C@H]([C@@H](COP(=O)(O)O)O)O |
Properties | |
Molecular formula | C5H11O7P |
Molar mass | 214.11 |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
1-Deoxy-D-xylulose 5-phosphate is an intermediate in the non-mevalonate pathway.