Tryptophan (data page)
From Wikipedia, the free encyclopedia
The complete data for Tryptophan | ||||||||||||||||
General information Chemical formula: C11H11N2O2
Molecular mass: 204.23 g·mol-1 Systematic name: (S)-2-Amino-3-(1H-indol-3-yl)-propanoic acid Abbreviations: W, Trp Synonyms: none |
||||||||||||||||
Database data | ||||||||||||||||
SMILES: C(N)(C(=O)O)CC1c2ccccc2NC=1 InChI=1/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m1/s1/f/h14H 1/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/f/h5H
|
||||||||||||||||
Physical properties | ||||||||||||||||
|
||||||||||||||||
Hazard properties | ||||||||||||||||
|
||||||||||||||||
Chemical properties | ||||||||||||||||
|
||||||||||||||||
Pharmacological properties | ||||||||||||||||
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
[edit] References
Biochemicals | Major Families of||
Peptides | Amino acids | Nucleic acids | Carbohydrates | Lipids | Terpenes | Carotenoids | Tetrapyrroles | Enzyme cofactors | Steroids | Flavonoids | Alkaloids | Polyketides | Glycosides | ||
Analogues of nucleic acids: | The 20 Common Amino Acids | Analogues of nucleic acids: |
Alanine (dp) | Arginine (dp) | Asparagine (dp) | Aspartic acid (dp) | Cysteine (dp) | Glutamic acid (dp) | Glutamine (dp) | Glycine (dp) | Histidine (dp) | Isoleucine (dp) | Leucine (dp) | Lysine (dp) | Methionine (dp) | Phenylalanine (dp) | Proline (dp) | Serine (dp) | Threonine (dp) | Tryptophan (dp) | Tyrosine (dp) | Valine (dp) |