Trichloroisocyanuric acid
From Wikipedia, the free encyclopedia
| Trichloroisocyanuric acid | |
|---|---|
  |
|
| General | |
| Systematic name | 1,3,5-trichloro-1,3,5- triazinane-2,4,6-trione |
| Other names | TCICA 1,3,5-trichloro-1,3,5-triazine -2,4,6(1H,3H,5H)-trione |
| Chemical formula | C3Cl3N3O3 |
| SMILES | C1(=O)N(C(=O)N(C(=O)N1Cl)Cl)Cl |
| Molecular mass | 232.41 g/mol |
| Appearance | colourless solid |
| CAS number | 87-90-1 |
| Properties | |
| Density | 2.19 ± 0.1 g/cm³ |
| Solubility in water | 0.2% |
| Other solvents | chlorocarbons acetone acetonitrile |
| Melting point | 249-51 °C |
| Boiling point | decomp. |
| Structure | |
| geometry | planar |
| Crystal structure | |
| Dipole moment | 0 D |
| Hazards | |
| MSDS | External MSDS |
| Main hazards | lung irritant |
| NFPA 704 | |
| Flash point | NA |
| R/S statement | R: 8-22-31-36/37-50/53 S: 8-26-41-60-61 |
| RTECS number | XZ1925000 |
| Supplementary data page | |
| Structure and properties |
n, εr, etc. |
| Thermodynamic data |
Phase behaviour Solid, liquid, gas |
| Spectral data | UV, IR, NMR, MS |
| Related compounds | |
| Related compounds | Cyanuric chloride dichloroisocyanuric acid |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Trichloroisocyanuric acid (C3Cl3N3O3), also known as Symclosene, trichloro-s-triazinetrione, and trichlor, is a chemical compound used as an industrial disinfectant and a reagent in organic synthesis.[1] This white crystalline powder, which has a strong "chlorine odour," is sometimes sold in tablet or granule form for domestic use.
[edit] Use in water treatment
The compound is a disinfectant mainly for swimming pool water.
[edit] See also
[edit] References and external links
- ^ Hiegel, G. A. "Trichloroisocyanuric Acid" in Encyclopedia of Reagents for Organic Synthesis 2001, John Wiley & Sons: New York. DOI: 10.1002/047084289X.rt209
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
