Styphnic acid
From Wikipedia, the free encyclopedia
| Styphnic acid | |
|---|---|
 |
|
| Chemical name | 2,4,6-trinitrobenzene-1,3-diol |
| Chemical formula | C6H3N3O8 |
| Molecular mass | 245.11 g/mol |
| CAS number | [82-71-3] |
| Density | 1.829 g/cm3 |
| Melting point | 180 °C |
| Boiling point | dec. |
| SMILES | OC1=C([N+]([O-])=O)C(O)=C ([N+]([O-])=O)C=C1[N+]([O-])=O |
| Disclaimer and references | |
Styphnic acid, or 2,4,6-trinitro-1,3-benzenediol, is a yellow astringent acid that forms hexagonal crystals. It is made by a reaction between nitric acid and resorcinol. It is used in the manufacture of dyes, pigments, inks, medicines, and explosives such as lead styphnate. It is itself an explosive, similar to picric acid.
[edit] External links
 |
This article about an alcohol is a stub. You can help Wikipedia by expanding it. |
