Sinapyl alcohol
From Wikipedia, the free encyclopedia
| Sinapyl alcohol | |
|---|---|
 |
|
| Identifiers | |
| CAS number | [] |
| SMILES | OC/C=C/c1cc(OC)c(O)c(OC)c1 |
| Properties | |
| Molecular formula | C11H14O4 |
| Molar mass | 210.226 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Sinapyl alcohol, also called sinapoyl alcohol or 4-(3-hydroxy-1-propenyl)-2,6-dimethoxy-phenol, is a phytochemical, one of the monolignols. It is synthetized via the phenylpropanoid biochemical pathway. When polymerized, sinapyl alcohol forms lignin or lignans.
Sinapyl alcohol is also a precursor for biosynthesis of stilbene and coumarin.
