Pifithrin
From Wikipedia, the free encyclopedia
| Pifithrin | |
|---|---|
 |
|
| Systematic name | 2-amino-3-[2-(4-methylphenyl)-2-oxoethyl]-2,3,4,5,6,7-hexahydro-1,3-benzothiazol-2-ylium bromide |
| Chemical formula | C16H19BrN2OS |
| Molecular mass | 367.30 g/mol |
| Density | x.xxx g/cm³ |
| Melting point | 192.1 °C |
| Boiling point | xx.x °C |
| CAS number | [xx-xx-xx] |
| SMILES | [Br-].Cc1ccc(cc1)C(=O)Cn2[c+](N)sc3CCCCc23 |
| Disclaimer and references | |
Pifithrin (chemical name 2-(2-Imino-4,5,6,7-tetrahydrobenzothiazol-3-yl)-1-p-tolylethanone hydrobromide) is an off-white in color chemical inhibitor of p53. It has a molecular weight of 367.30 and is souble in DMSO up to 20 mg/mL. It's melting point is 192.1-192.5 °C
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
