Lysophosphatidic acid
From Wikipedia, the free encyclopedia
| Lysophosphatidic acid | |
|---|---|
 |
|
| Identifiers | |
| CAS number | [] |
| PubChem | |
| MeSH | |
| SMILES | OP(O)(=O)OCC(O)COC(=O)CCCCCCC\C=C\CCCCCCCC |
| Properties | |
| Molecular formula | C21H41O7P |
| Molar mass | 436.52 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Lysophosphatidic acid (LPA) is a phospholipid derivative that acts as a potent signaling molecule. There are a number of potential routes to its biosynthesis, but the most well-characterized is by the action of a lysophospholipase D called autotaxin which removes the choline group from lysophosphatidylcholine. LPA acts as a potent mitogen due to its activation of three high-affinity G-protein coupled receptors called LPA1, LPA2, and LPA3 (also known as EDG2, EDG4, and EDG7).
Because of its ability to stimulate cell-proliferation, aberrant LPA-signaling has been linked to cancer in numerous ways. Dysregulation of autotaxin or the LPA receptors can lead to hyperproliferation which may contribute to oncogenesis and metastasis.
[edit] See also
[edit] References
- Moolenar, W.H., Lysophosphatidic Acid, a Multifunctional Phospholipid Messenger. J. Biol. Chem. 1995. (270)22:12949. Article.
- Mills, G.B., Moolenaar, W.H., The Emerging role of lysophosphatidic acid in cancer. Nat. Rev. Cancer. 2003. (8):582. Article
 |
This chemistry article is a stub. You can help Wikipedia by expanding it. |
