Galactosamine
From Wikipedia, the free encyclopedia
| Galactosamine | |
|---|---|
 |
|
 |
|
| IUPAC name | 2-Amino-2-deoxy-D-galactose |
| Other names | α-D-galactosamine |
| Identifiers | |
| CAS number | [] |
| PubChem | |
| SMILES | O=C[C@H](N)[C@@H](O)[C@@H](O)[C@H](O)CO |
| Properties | |
| Molecular formula | C6H13NO5 |
| Molar mass | 179.171 g/mol |
| Melting point |
180 °C (HCl salt) |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Galactosamine is a hexosamine derived from galactose with the molecular formula C6H13NO5. This amino sugar is a constituent of some glycoprotein hormones such as follicle-stimulating hormone (FSH) and luteinizing hormone (LH). Other sugar constituents of FSH and LH include glucosamine, galactose and glucose.
[edit] See also
[edit] References
- ^ Merck Index, 11th Edition, 4240.
[edit] External links
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
