Fenoxycarb
From Wikipedia, the free encyclopedia
| Fenoxycarb | |
|---|---|
 |
|
| Systematic name | ethyl N-[2-(4-phenoxyphenoxy)ethyl]carbamate |
| Other names | Varikill, Insegar, Logic |
| Chemical formula | C17H19NO4 |
| Molecular weight | 301.34 g/mol |
| Melting point | 53.5 °C |
| Solubility | 6 mg/L |
| CAS number | [72490-01-8] |
| SMILES | CCOC(=O)NCCOC1=CC=C(C=C1)OC2=CC=CC=C2 |
| Disclaimer and references | |
Fenoxycarb is a carbamate insecticide. It has a low toxicity for bees, birds, and humans, but is toxic to fish.
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
