Cordycepin
From Wikipedia, the free encyclopedia
| Cordycepin | |
|---|---|
 |
|
| Chemical name | 9-(3-Deoxy-β-D-ribofuranosyl)adenine |
| Other names | Cordycepine 3'-Deoxyadenosine |
| Chemical formula | C10H13N5O3 |
| Molecular mass | g/mol |
| CAS number | [73-03-3] |
| Density | ? g/cm3 |
| Melting point | 225.5 °C |
| SMILES | O[C@@H]1C[C@@H](CO)O[C@H]1N2C(N=CN=C3N)=C3N=C2 |
| Disclaimer and references | |
Cordycepin, or 3-deoxyadenosine, is a derivative of the nucleoside adenosine, differing from the latter by the absence of oxygen in the 3' position of its ribose part.
It was initially extracted from fungi of genus Cordyceps, but is now produced synthetically.
Being similar to adenosine, some enzymes cannot discriminate between them. Hence it can participate in certain biochemical reactions (for example, be incorporated into an RNA molecule, thus causing the premature termination of its synthesis).
[edit] See also
[edit] References
- Siev et al, 1969 [1]
