Chrysene
From Wikipedia, the free encyclopedia
| Chrysene[1] | |
|---|---|
 |
|
| IUPAC name | Chrysene |
| Other names | Benzo[a]phenanthrene 1,2-Benzphenanthrene |
| Identifiers | |
| CAS number | [] |
| PubChem | |
| EINECS number | |
| RTECS number | GC0700000 |
| SMILES | C12=CC=CC=C1C3=C(C(C=CC=C4)=C4C=C3)C=C2 |
| InChI | InChI=1/C18H12/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18/h1-12H |
| Properties | |
| Molecular formula | C18H12 |
| Molar mass | 228.28 |
| Appearance | Orthorhombic bipyramidal plates |
| Density | 1.274 g/cm3 |
| Melting point |
254 °C, 527 K, 489 °F |
| Boiling point |
448 °C, 721 K, 838 °F |
| Solubility in water | Insoluble |
| Solubility in Ethanol | 1 gm/1300 mL |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Chrysene is a polycyclic aromatic hydrocarbon (PAH) with the molecular formula C18H12 that consists of four fused benzene rings. It is a natural constituent of coal tar, from which it was first isolated and characterized. It is also found in creosote, a chemical used to preserve wood.
Chrysene is formed in small amounts during the burning or distillation of coal, crude oil, and plant material.
Contents |
[edit] Use
Chrysene is used in the manufacture of some dyes.
[edit] Safety
As with other PAHs, chrysene is suspected to be a human carcinogen. It is known to cause cancer in laboratory animals.[2]
[edit] See also
[edit] References
- ^ Merck Index, 11th Edition, 2259.
- ^ TOXICOLOGICAL PROFILE FOR POLYCYCLIC AROMATIC HYDROCARBONS
