Chromotropic acid
From Wikipedia, the free encyclopedia
| Chromotropic acid | |
|---|---|
 |
|
| Systematic name | 3,5-dihydroxynaphthalene-1,7-disulfonic acid |
| Chemical formula | C10H8O8S2 |
| Molecular mass | 320.30 g/mol |
| Density | x.xxx g/cm³ |
| Melting point | xx.x °C |
| Boiling point | xx.x °C |
| CAS number | [148-25-4] |
| SMILES | OS(=O)(=O)c1cc(O)c2cc(O)cc(c2c1)S(O)(=O)=O |
| Disclaimer and references | |
Also known as chromotropic acid disodium salt, chromotropic acid's formula is (HO)2C10H4(SO3Na)2.2H2O
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
