Chlorbenside
From Wikipedia, the free encyclopedia
Chlorbenside | |
---|---|
IUPAC name | 1-Chloro-4-[(4-chlorophenyl)sulfanylmethyl]benzene |
Other names | Chlorparaside Chlorsulfacide Chlorsulphacide Chlorbenxide Chlorbenzide Mitox |
Identifiers | |
CAS number | [ | ]
PubChem | |
SMILES | ClC1=CC=C(SCC2=CC=C(Cl)C=C2)C=C1 |
Properties | |
Molecular formula | C13H10Cl2S |
Molar mass | 269.19 g/mol |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
Chlorbenside (C13H10Cl2S), also known as chlorparaside and chlorsulfacide, is a pesticide, most commonly used as an acaricide.