Carboxyglutamate
From Wikipedia, the free encyclopedia
 |
|
|
Carboxyglutamate |
|
| Systematic (IUPAC) name | |
| 3-aminopropane-1,1,3-tricarboxylic acid | |
| Identifiers | |
| PubChem | 40772 |
| Chemical data | |
| Formula | C6H9NO6 |
| Mol. weight | 191.139 |
| SMILES | C(C(C(=O)O)C(=O)O)C(C(=O)O)N |
| Complete data | |
γ-carboxyglutamate is an uncommon amino acid found in clotting factors. It is formed by post-translational carboxylation of glutamate.
[edit] See also
[edit] External links
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
