Calcium tartrate
From Wikipedia, the free encyclopedia
Calcium tartrate | |
---|---|
Image:Calcium tartrate.jpg | |
General | |
Systematic name | 2,3-Dihydroxybutendioic acid calcium salt |
Molecular formula | CaC4H4O6 |
SMILES | [Ca++]-OC(=O)C(O)C(O)C(=O)O- |
Molar mass | 188.15 g/mol (anhydrous) 260.21 g/mol (tetrahydrate) |
Appearance | hygroscopic white powder or colorless crystals |
CAS number | [3164-34-9] dihydrate [5892-21-7] anhydrous |
Properties | |
Density | 1.817 g/cm3 tetrahydrate |
Solubility in water | 0.037 g/100 ml (0°C) |
HCl ethanol |
soluble slightly soluble |
Melting point | tetrahydrate decomposes at 160°C anhydrous decomposes at 650°C |
Chiral rotation [α]D | ?° |
Structure | |
Crystal structure | d or l rhombic dl triclinic |
Hazards | |
MSDS | Calcium tartrate |
Main hazards | ? |
NFPA 704 | |
R/S statement | R: ? S: ? |
RTECS number | ? |
Supplementary data page | |
Structure and properties |
n, εr, etc. |
Thermodynamic data |
Phase behaviour Solid, liquid, gas |
Spectral data | UV, IR, NMR, MS |
Related compounds | |
tartaric acid | |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
Calcium tartrate is a byproduct of the wine industry, prepared from wine fermentation dregs. It finds use as a food preservative. Like tartaric acid, calcium tartrate has two asymmetric carbons, hence it has two chiral isomers and a non-chiral isomer. Most calcium tartrate of biological origin is the chiral levorotatory (–) isomer.