Calcium tartrate
From Wikipedia, the free encyclopedia
 |
This chemistry article is a stub. You can help Wikipedia by expanding it. |
| Calcium tartrate | |
|---|---|
| Image:Calcium tartrate.jpg | |
| General | |
| Systematic name | 2,3-Dihydroxybutendioic acid calcium salt |
| Molecular formula | CaC4H4O6 |
| SMILES | [Ca++]-OC(=O)C(O)C(O)C(=O)O- |
| Molar mass | 188.15 g/mol (anhydrous) 260.21 g/mol (tetrahydrate) |
| Appearance | hygroscopic white powder or colorless crystals |
| CAS number | [3164-34-9] dihydrate [5892-21-7] anhydrous |
| Properties | |
| Density | 1.817 g/cm3 tetrahydrate |
| Solubility in water | 0.037 g/100 ml (0°C) |
| HCl ethanol |
soluble slightly soluble |
| Melting point | tetrahydrate decomposes at 160°C anhydrous decomposes at 650°C |
| Chiral rotation [α]D | ?° |
| Structure | |
| Crystal structure | d or l rhombic dl triclinic |
| Hazards | |
| MSDS | Calcium tartrate |
| Main hazards | ? |
| NFPA 704 | |
| R/S statement | R: ? S: ? |
| RTECS number | ? |
| Supplementary data page | |
| Structure and properties |
n, εr, etc. |
| Thermodynamic data |
Phase behaviour Solid, liquid, gas |
| Spectral data | UV, IR, NMR, MS |
| Related compounds | |
| tartaric acid | |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Calcium tartrate is a byproduct of the wine industry, prepared from wine fermentation dregs. It finds use as a food preservative. Like tartaric acid, calcium tartrate has two asymmetric carbons, hence it has two chiral isomers and a non-chiral isomer. Most calcium tartrate of biological origin is the chiral levorotatory (–) isomer.
