Acenaphthoquinone
From Wikipedia, the free encyclopedia
 Acenaphthoquinone |
|
| Chemical name Acenaphthoquinone |
|
| General | |
|---|---|
| Chemical formula | C12H6O2 |
| SMILES | c1ccc2c3c1cccc3C(=O)C2(=O) |
| Molecular weight | 182.18 g/mol |
| Appearance | Purple-yellow crystals to brown powder |
| CAS number | [] |
| MSDS | Acenaphthoquinone MSDS |
| Other names | |
|
|
| Physical properties | |
| Density and phase at STP | ? |
| Solubility | 90.1 mg/L Insoluble (soluble in alcohol) |
| Specific gravity | ? |
| Crystal structure | ? |
| pH (10% solution with water) (pKa) |
? |
| Acidity constant (pKa) |
? |
| Thermal decomposition | ? K (? °C) |
| Phase behavior | |
| Melting point | 530–534 K (257–261 °C) |
| Boiling point | ? |
| Triple point | ? |
| Critical point | ? |
| Heat of fusion (ΔfusH) |
? |
| Entropy of fusion (ΔfusS) |
? |
| Heat of vaporization (ΔvapH) |
? |
| Safety | |
| Ingestion | May cause gastrointestinal irritation with nausea, vomiting and diarrhea |
| Inhalation | Causes respiratory tract irritation. Can produce delayed pulmonary edema |
| Skin | Causes skin irritation. |
| Eyes | Causes eye irritation. May cause chemical conjunctivitis. |
| Flash point | ? |
| Autoignition temperature | ? |
| Explosive limits | ? |
| OSHA Permissible Exposure Limit (PEL) |
? |
| NIOSH Immediate Danger to Life and Health (IDLH) |
? |
| Precautions | |
|
|
| Solid properties | |
| Standard enthalpy change of formation (ΔfH0solid) |
? |
| Standard molar entropy (S0solid) |
? |
| Heat capacity (Cp) |
? |
| Liquid properties | |
| ΔfH0liquid | ? |
| S0liquid | ? |
| Cp | ? |
| Density | ? |
| Gas properties | |
| ΔfH0gas | ? |
| S0gas | ? |
| Cp | ? |
|
Except where noted, all data was produced under conditions of standard temperature and pressure. |
|
Acenaphthoquinone is a polycyclic aromatic hydrocarbon derived from naphthalene. It is used as an intermediate for the manufacturing of dyes, pharmaceuticals and pesticides. It is also used in chemical research as a drug and therapeutic agent.
The substance is classified as an irritant. Its carcinogenic properties have not been fully investigated yet.
Its formula is C12H6O2.
[edit] External links
- National Pollutant Inventory - Polycyclic Aromatic Hydrocarbon Fact Sheet
- PAHs - including structural diagrams
- Entry at ChemicalLand21.com
- Links to external chemical sources
 |
This article about an aromatic compound is a stub. You can help Wikipedia by expanding it. |
