5,12-Bis(phenylethynyl)naphthacene
From Wikipedia, the free encyclopedia
| 5,12-Bis(phenylethynyl)naphthacene | |
|---|---|
 |
|
| IUPAC name | 5,12-Bis(phenylethynyl)naphthacene |
| Other names | 5,12-Bis(phenylethynyl)tetracene |
| Identifiers | |
| CAS number | [] |
| PubChem | |
| EINECS number | |
| SMILES | C12=CC=CC=C1C=C3C(C(C#CC6=CC=CC=C6)=C(C=CC=C5)C5=C3C#CC4=CC=CC=C4)=C2 |
| InChI | InChI=1/C34H20/c1-3-11-25(12-4-1)19-21-31-29-17-9-10-18-30(29)32(22-20-26-13-5-2-6-14-26)34-24-28-16-8-7-15-27(28)23-33(31)34/h1-18,23-24H |
| Properties | |
| Molecular formula | C34H20 |
| Molar mass | 428.52 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
5,12-Bis(phenylethynyl)naphthacene is a fluorescent dye used in lightsticks. It yields orange light.
[edit] External links
 |
This article about a hydrocarbon is a stub. You can help Wikipedia by expanding it. |
