1,2-Propanedithiol
From Wikipedia, the free encyclopedia
| 1,2-Propanedithiol | |
|---|---|
 |
|
| IUPAC name | Propane-1,2-dithiol |
| Other names | 1,2-Dimercaptopropane |
| Identifiers | |
| CAS number | [] |
| PubChem | |
| SMILES | SCC(S)C |
| InChI | InChI=1/C3H8S2/c1-3(5)2-4/h3-5H,2H2,1H3 |
| Properties | |
| Molecular formula | C3H8S2 |
| Molar mass | 108.22 g/mol |
| Boiling point |
152 °C, 425 K, 306 °F |
| Solubility in water | organic solvents |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
1,2-Propanedithiol, sometimes called 1,2-dimercaptopropane, is a thiol with the formula HSCH2CH(SH)CH3. This colorless, intensely odourous liquid is the simplest chiral dithiol. Related dithiols include 1,2-ethanedithiol, 2,3-dimercapto-1-propanesulfonic acid, and 1,3-propanedithiol. It is generated by the addition of H2S to the related episulfide, CH3CHCH2S.
Refractive index = 1.531-1.541
[edit] References
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
