1,2,4-Trichlorobenzene
From Wikipedia, the free encyclopedia
| 1,2,4-Trichlorobenzene | |
|---|---|
 |
|
| IUPAC name | 1,2,4-Trichlorobenzene |
| Identifiers | |
| CAS number | [] |
| PubChem | |
| SMILES | Clc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1/C6H3Cl3/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| Properties | |
| Molecular formula | C6H3Cl3 |
| Molar mass | 181.45 g/mol |
| Appearance | Colorless liquid |
| Density | 1.46 g·cm3 |
| Melting point |
16.9 °C |
| Boiling point |
214.4 °C |
| Solubility in water | Insoluble |
| Hazards | |
| Flash point | 110 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
1,2,4-Trichlorobenzene is an organic compound used as a solvent, and is one of the best known solvents used to dissolve fullerenes. It is a benzene derivative with three chlorine atoms substitutents, in the 1, 2 and 4 positions of the benzene ring.
[edit] See also
 |
This article about an organic halide is a stub. You can help Wikipedia by expanding it. |
