Stearidonic acid
From Wikipedia, the free encyclopedia
| Stearidonic acid | |
|---|---|
 |
|
| Chemical name | (6Z,9Z,12Z,15Z)-6,9,12,15-octadecatetraenoic acid |
| Chemical formula | C18H28O2 |
| Molecular mass | 276.40 g/mol |
| CAS number | [20290-75-9] |
| Density | ? g/cm3 |
| Melting point | ? °C |
| Boiling point | ? °C |
| SMILES | OC(CCC/C=C\C/C=C\C/C=C\C/C=C\CC)=O |
| Disclaimer and references | |
Stearidonic acid is an ω-3 essential fatty acid, sometimes called moroctic acid. It is biosynthesized from alpha-linolenic acid by the enzyme delta-6 desaturase. Natural sources of this fatty acid are hemp seed and blackcurrant seed oils.
[edit] See Also
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
