Oleic acid
From Wikipedia, the free encyclopedia
| Oleic acid | |
|---|---|
|
|
| General | |
| Systematic name | (9Z)-octadec-9-enoic acid |
| Other names | (9Z)-Octadecenoic acid (Z)-Octadec-9-enoic acid cis-9-octadecenoic acid cis-Δ9-octadecenoic acid Oleic acid 18:1 cis-9 |
| Molecular formula | C18H34O2 |
| SMILES | CCCCCCCC\C=C/CCCCCCCC(O)=O |
| InChI | 1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11 -12-13-14-15-16-17-18(19)20/h9-10H,2-8, 11-17H2,1H3,(H,19,20)/b10-9- |
| Molar mass | 282.2559 g/mol |
| Appearance | Pale yellow or brownish yellow oily liquid with lard-like odor |
| CAS number | [112-80-1] [1] |
| Properties | |
| Density and phase | 0.895-.947 g/cm³ |
| Solubility in water | Insoluble in water |
| Melting point | 13-14°C (? K) |
| Boiling point | 360°C (? K) (760mm Hg) |
| Acidity (pKa) | ? |
| Basicity (pKb) | ? |
| Chiral rotation [α]D | ?° |
| Viscosity | ? cP at ?°C |
| Structure | |
| Molecular shape | ? |
| Coordination geometry |
? |
| Crystal structure | ? |
| Dipole moment | ? D |
| Hazards | |
| MSDS | External MSDS |
| Main hazards | ? |
| NFPA 704 | |
| Flash point | ?°C |
| R/S statement | R: ? S: ? |
| RTECS number | ? |
| Supplementary data page | |
| Structure and properties |
n, εr, etc. |
| Thermodynamic data |
Phase behaviour Solid, liquid, gas |
| Spectral data | UV, IR, NMR, MS |
| Related compounds | |
| Other anions | ? |
| Other cations | ? |
| Related ? | ? |
| Related compounds | ? |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Oleic acid is a monounsaturated omega-9 fatty acid found in various animal and vegetable sources. It has the formula C18H34O2 (or CH3(CH2)7CH=CH(CH2)7COOH). The saturated form of this acid is stearic acid. It is used in Lorenzo's oil.
Oleic acid comprises 55-80% of olive oil, though there may be only 0.5-2.5% or so as actual free acid, and 15-20% of grape seed oil and Sea Buckthorn oil.
Reduction of oleic acid yields oleyl alcohol.
[edit] Reference
- ↑ Bishop, Paul L. (2000). Pollution Prevention: Chapter 2 - Properties and Fates of Environmental Contaminants, instructional slides to accompany Pollution Prevention:Fundamentals and Practice, by Paul L. Bishop (ISBN 0-07-366147-3). Retrieved 2005-03-07.
- ↑ Li, Thomas S. C. (1999). Sea buckthorn: New crop opportunity, from Perspectives on new crops and new uses by J. Janeck (ed.) Retrieved 2006-10-28.
