Octyl methoxycinnamate
From Wikipedia, the free encyclopedia
| Octyl methoxycinnamate | |
|---|---|
 |
|
| Chemical name | 2-Ethylhexyl 3-(4-methoxyphenyl)propenoate |
| Other names | Octyl methoxycinnamate Octinoxate Tinosorb OMC |
| Chemical formula | C18H26O3 |
| Molecular mass | 290.40 g/mol |
| CAS number | [5466-77-3] |
| Density | 1.01 g/cm3 |
| Melting point | -25 °C |
| Boiling point | 198-200 °C |
| SMILES | O=C(OCC(CC)CCCC)/C=C/C1=CC=C(OC)C=C1 |
| NFPA 704 |
1
1
0
|
| Disclaimer and references | |
Octyl methoxycinnamate, or octinoxate, is an organic compound that is an ingredient in some sunscreens. It is an ester formed from methoxycinnamic acid and 2-ethylhexanol. It is a clear liquid that is insoluble in water.
Its primary use is in suncreens and other comsmetics to absorb UV-B rays from the sun, protecting the skin from damage.
[edit] See also
- Cinoxate, another cinnamic acid based sunscreen ingredient
[edit] References
- Merck Index, 11th Edition, 6687.
