Norbaeocystin
From Wikipedia, the free encyclopedia
| Norbaeocystin | |
|---|---|
| Chemical name | 4-phosphoryloxytryptamine or phosphoric acid mono- [3-(2-aminoethyl)-indol-4-yl] ester |
| Chemical formula | C10H13N2O4P |
| Molecular mass | 256.19 g/mol |
| Melting point | (decomposes) |
| CAS number | |
| SMILES | [NH3+]CCC1=CNC2=C1C(OP([O-])(O)=O)=CC=C2 |
 |
|
Norbaeocystin is a mushroom alkaloid and analog of the psychedelic hallucinogenic drug psilocybin. It is found as a minor compound in most psilocybin mushrooms together with psilocin, psilocybin and baeocystin. It is not known if this base contributes to the entheogenic effects of mushrooms.
[edit] External links
| Tryptamines - edit |
|---|
|
4-Acetoxy-DET | 4-Acetoxy-DIPT | 4-Acetoxy-DMT | 4-HO-DIPT | 5-MeO-α-ET | 5-MeO-α-MT | 5-MeO-DALT | 5-MeO-DET | 5-MeO-DIPT | 5-MeO-DMT | 5-MeO-DPT | 5-MeO-MIPT | α-ET | α-MT | Baeocystin | Bufotenin | DET | DIPT | DMT | DPT | Ethocybin | EIPT | Ethocin | Ibogaine | Iprocin | MET | MIPT | Miprocin | Melatonin | NMT | Norbaeocystin | Psilocin | Psilocybin | Rizatriptan | Serotonin | Sumatriptan | Tryptamine | Tryptophan |
 |
This article related to psychedelics, dissociatives and deliriants is a stub. You can help Wikipedia by expanding it. |
