Benzil
From Wikipedia, the free encyclopedia
| Benzil | |
|---|---|
 |
|
| General | |
| Systematic name | 1,2-diphenylethanedione |
| Other names | dibenzoyl bibenzoyl diphenylglyoxal |
| Molecular formula | C14H10O2 |
| SMILES | O=C(C(=O)c1ccccc1)c2ccccc2 |
| Molar mass | 210.23 g/mol |
| Appearance | yellow crystals or powder |
| CAS number | [134-81-6] |
| Properties | |
| Density and phase | 1.23 g/cm3, solid |
| Solubility in water | insoluble |
| Solubility in ethanol | soluble |
| Solubility in diethyl ether | soluble |
| Solubility in benzene | soluble |
| Melting point | 94-95 °C (367-368 K) |
| Boiling point | 346-348 °C (619-621 K) |
| Structure | |
| Crystal structure | P31,221 Acta Cryst. B43 398 (1987) |
| Dipole moment | ? D |
| Hazards | |
| MSDS | External MSDS |
| Main hazards | Irritant |
| NFPA 704 | |
| Flash point | ? °C |
| R/S statement | R: ? S: ? |
| RTECS number | ? |
| Supplementary data page | |
| Structure and properties |
n, εr, etc. |
| Thermodynamic data |
Phase behaviour Solid, liquid, gas |
| Spectral data | UV, IR, NMR, MS |
| Related compounds | |
| Related diketones | biacetyl |
| Related compounds | benzophenone glyoxal |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Benzil is the organic compound with the formula (C6H5CO)2, generally abbreviated (PhCO)2.This diketone is used as an intermediate in organic synthesis.
Benzil can be prepared in the laboratory by the benzoin condensation of benzaldehyde followed by oxidation of benzoin using copper sulfate.[1]
- PhC(O)CH(OH)Ph + 2 Cu2+ → PhC(O)C(O)Ph + 2 H+ + 2 Cu+
A classical organic reaction of benzil is the Benzilic acid rearrangement to benzilic acid.
[edit] References
- ^ Clarke, H. T.; Dreger.E. E. "Benzil" Organic Syntheses, Collected Volume 1, p.87 (1941).
[edit] External links
 |
This article about an aromatic compound is a stub. You can help Wikipedia by expanding it. |
