Anthrone
From Wikipedia, the free encyclopedia
| Anthrone | |
|---|---|
 |
|
| General | |
| Systematic name | 10H-anthracen-9-one |
| Other names | Carbothrone Anthranone 9-Oxoanthracene |
| Molecular formula | C14H10O |
| SMILES | C1C2=CC=CC=C2C(=O)C3=CC=CC=C31 |
| InChI | InChI=1/C14H10O /c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14 /h1-8H,9H2 |
| Molar mass | 194.229 g/mol |
| Appearance | white to light yellow needle crystals |
| CAS number | [90-44-8] |
| Properties | |
| Density and phase | Solid |
| Solubility in water | Insoluble |
| Melting point | 155 - 158 °C (428 - 431 K) |
| Boiling point | 721 °C (994 K) |
| Related compounds | |
| Related hydrocarbons |
Anthracene |
| Except where noted otherwise, data are given for materials in their standard state (at 25°C, 100 kPa) Infobox disclaimer and references |
|
Anthrone is a tricyclic aromatic hydrocarbon. It is used for a popular cellulose assay.
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
