5-MeO-DPT
From Wikipedia, the free encyclopedia
| 5-MeO-DPT | |
|---|---|
| Chemical name | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-propylpropan-1-amine |
| Chemical formula | C17H26N2O |
| Molecular mass | 274.40 g/mol |
| Melting point | 193-194 °C(hydrochloride) |
| CAS numbers | 2427-80-7 |
| SMILES | CCCN(CCC)CC\C2=C\Nc1ccc(cc12)OC |
 |
|
5-MeO-DPT (also known as 5-methoxy-N,N-Dipropyltryptamine), is a hallucinogenic and entheogenic drug.
Contents |
[edit] Chemistry
The full chemical name is N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-propylpropan-1-amine. It is classified as a tryptamine derivative, and as an indole compound.
[edit] Effects
Little is known about the subjective effects of 5-MeO-DPT, but the nature of the compound probably comparable to psilocybin/psilocin, or DPT, which are also psychedelic tryptamines/indoles. However, the duration of the above mentioned drugs vary considerably.
[edit] Dosage
5-MeO-DPT is orally active, with 6-10 mg represents a fully effective dosage for most users. Effects begin within an hour, and usually last 4-6 hours.
[edit] External links
| Tryptamines - edit |
|---|
|
4-Acetoxy-DET | 4-Acetoxy-DIPT | 4-Acetoxy-DMT | 4-HO-DIPT | 5-MeO-α-ET | 5-MeO-α-MT | 5-MeO-DALT | 5-MeO-DET | 5-MeO-DIPT | 5-MeO-DMT | 5-MeO-DPT | 5-MeO-MIPT | α-ET | α-MT | Baeocystin | Bufotenin | DET | DIPT | DMT | DPT | Ethocybin | EIPT | Ethocin | Ibogaine | Iprocin | MET | MIPT | Miprocin | Melatonin | NMT | Norbaeocystin | Psilocin | Psilocybin | Rizatriptan | Serotonin | Sumatriptan | Tryptamine | Tryptophan |
 |
This article related to psychedelics, dissociatives and deliriants is a stub. You can help Wikipedia by expanding it. |
