4-Phenyl-4-(1-piperidinyl)cyclohexanol
From Wikipedia, the free encyclopedia
| 4-Phenyl-4-(1-piperidinyl)cyclohexanol | |
|---|---|
 |
|
 |
|
| Systematic name | 4-Phenyl-4-(1-piperidinyl)cyclohexanol |
| Chemical formula | C17H25NO |
| Molecular mass | 259.391 g/mol |
| Density | x.xxx g/cm3 |
| Melting point | xx.x °C |
| Boiling point | xx.x °C |
| CAS number | [xx-xx-xx] |
| SMILES | OC1CCC(N2CCCCC2)(C3=CC=CC=C3)CC1 |
| Disclaimer and references | |
4-Phenyl-4-(1-piperidinyl)-cyclohexanol, also known as PPC, is an organic chemical which is often found as a metabolite of phencyclidine (PCP).
[edit] External links
 |
This article about an amine is a stub. You can help Wikipedia by expanding it. |
